C12H17FN2O2 — CID 103296803
5-amino-2-fluoro-N-(1-hydroxypropan-2-yl)-N,3-dimethylbenzamide (PubChem CID 103296803) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(1-hydroxypropan-2-yl)-N,3-dimethylbenzamide.
| Compound Name | 5-amino-2-fluoro-N-(1-hydroxypropan-2-yl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 103296803 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-amino-2-fluoro-N-(1-hydroxypropan-2-yl)-N,3-dimethylbenzamide |
| SMILES | Cc1cc(N)cc(C(=O)N(C)C(C)CO)c1F |
| InChI | InChI=1S/C12H17FN2O2/c1-7-4-9(14)5-10(11(7)13)12(17)15(3)8(2)6-16/h4-5,8,16H,6,14H2,1-3H3 |
| InChIKey | JFYBZLUSIDRQLZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|