C11H12Cl2FNO2 — CID 113337578
2,4-dichloro-5-fluoro-N-(1-hydroxypropan-2-yl)-N-methylbenzamide (PubChem CID 113337578) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(1-hydroxypropan-2-yl)-N-methylbenzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 113337578 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(1-hydroxypropan-2-yl)-N-methylbenzamide |
| SMILES | CC(CO)N(C)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-6(5-16)15(2)11(17)7-3-10(14)9(13)4-8(7)12/h3-4,6,16H,5H2,1-2H3 |
| InChIKey | NHFYOAVJZVNSNQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|