C14H17Cl2FN2O2 — CID 46823565
2,4-dichloro-N-ethyl-5-fluoro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 46823565) has the molecular formula C14H17Cl2FN2O2 and a molecular weight of 335.21 g/mol. Its IUPAC name is 2,4-dichloro-N-ethyl-5-fluoro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-ethyl-5-fluoro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 46823565 |
| Molecular Formula | C14H17Cl2FN2O2 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2,4-dichloro-N-ethyl-5-fluoro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2FN2O2/c1-4-19(7-13(20)18-8(2)3)14(21)9-5-12(17)11(16)6-10(9)15/h5-6,8H,4,7H2,1-3H3,(H,18,20) |
| InChIKey | VNSCZCFUHGBXJO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|