C19H19Cl2FN2O2 — CID 55388510
2,4-dichloro-5-fluoro-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylbenzamide (PubChem CID 55388510) has the molecular formula C19H19Cl2FN2O2 and a molecular weight of 397.28 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylbenzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 55388510 |
| Molecular Formula | C19H19Cl2FN2O2 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2FN2O2/c1-3-8-24(11-18(25)23-17-7-5-4-6-12(17)2)19(26)13-9-16(22)15(21)10-14(13)20/h4-7,9-10H,3,8,11H2,1-2H3,(H,23,25) |
| InChIKey | JZSDCSRKUYXIFM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|