C23H24FN3O2 — CID 31978902
7-fluoro-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylquinoline-3-carboxamide (PubChem CID 31978902) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylquinoline-3-carboxamide.
| Compound Name | 7-fluoro-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 31978902 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 7-fluoro-2-methyl-N-[2-(2-methylanilino)-2-oxoethyl]-N-propylquinoline-3-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)C(=O)c1cc2ccc(F)cc2nc1C |
| InChI | InChI=1S/C23H24FN3O2/c1-4-11-27(14-22(28)26-20-8-6-5-7-15(20)2)23(29)19-12-17-9-10-18(24)13-21(17)25-16(19)3/h5-10,12-13H,4,11,14H2,1-3H3,(H,26,28) |
| InChIKey | GWEQWSJAVCKMEW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |