C16H12Cl3FN2O2 — CID 38660284
2,4-dichloro-N-[2-(2-chloroanilino)-2-oxoethyl]-5-fluoro-N-methylbenzamide (PubChem CID 38660284) has the molecular formula C16H12Cl3FN2O2 and a molecular weight of 389.64 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(2-chloroanilino)-2-oxoethyl]-5-fluoro-N-methylbenzamide.
| Compound Name | 2,4-dichloro-N-[2-(2-chloroanilino)-2-oxoethyl]-5-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 38660284 |
| Molecular Formula | C16H12Cl3FN2O2 |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 2,4-dichloro-N-[2-(2-chloroanilino)-2-oxoethyl]-5-fluoro-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3FN2O2/c1-22(8-15(23)21-14-5-3-2-4-10(14)17)16(24)9-6-13(20)12(19)7-11(9)18/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | XZIOYDLEAYZBED-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|