C18H17ClFN3O3 — CID 9409680
N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 9409680) has the molecular formula C18H17ClFN3O3 and a molecular weight of 377.80 g/mol. Its IUPAC name is N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 9409680 |
| Molecular Formula | C18H17ClFN3O3 |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H17ClFN3O3/c1-23(11-16(24)22-15-9-5-3-7-13(15)19)17(25)10-21-18(26)12-6-2-4-8-14(12)20/h2-9H,10-11H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | MZKHRNZQSCDROC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |