C20H20ClN3O3 — CID 9409762
(E)-N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 9409762) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is (E)-N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 9409762 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (E)-N-[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-24(14-19(26)23-17-10-6-5-9-16(17)21)20(27)13-22-18(25)12-11-15-7-3-2-4-8-15/h2-12H,13-14H2,1H3,(H,22,25)(H,23,26)/b12-11+ |
| InChIKey | YYLFLOHSNIKYMS-VAWYXSNFSA-N |
| XLogP | 2.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|