C20H20ClN3O5 — CID 7783318
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-benzamidoacetate (PubChem CID 7783318) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7783318 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-benzamidoacetate |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)COC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O5/c1-24(12-17(25)23-16-10-6-5-9-15(16)21)18(26)13-29-19(27)11-22-20(28)14-7-3-2-4-8-14/h2-10H,11-13H2,1H3,(H,22,28)(H,23,25) |
| InChIKey | HAROOJUSNXGQST-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |