C20H18ClN3O5 — CID 9317396
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate (PubChem CID 9317396) has the molecular formula C20H18ClN3O5 and a molecular weight of 415.83 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 9317396 |
| Molecular Formula | C20H18ClN3O5 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 2-(2-cyanophenoxy)acetate |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)COC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C20H18ClN3O5/c1-24(11-18(25)23-16-8-4-3-7-15(16)21)19(26)12-29-20(27)13-28-17-9-5-2-6-14(17)10-22/h2-9H,11-13H2,1H3,(H,23,25) |
| InChIKey | QMLMCVUAEAXTMO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |