C14H17ClN2O4 — CID 7851347
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate (PubChem CID 7851347) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 7851347 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)N(C)CC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O4/c1-3-14(20)21-9-13(19)17(2)8-12(18)16-11-7-5-4-6-10(11)15/h4-7H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | OYRJVMXNZSQTOK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |