C17H14Cl3N3O4 — CID 24979932
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 24979932) has the molecular formula C17H14Cl3N3O4 and a molecular weight of 430.68 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 24979932 |
| Molecular Formula | C17H14Cl3N3O4 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)COC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14Cl3N3O4/c1-23(8-14(24)21-12-5-3-2-4-10(12)18)15(25)9-27-17(26)16-11(19)6-7-13(20)22-16/h2-7H,8-9H2,1H3,(H,21,24) |
| InChIKey | GOTWLKMXMWWBNB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|