C19H19ClN2O5 — CID 7862045
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-methoxybenzoate (PubChem CID 7862045) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-methoxybenzoate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 7862045 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(C)CC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-22(11-17(23)21-16-6-4-3-5-15(16)20)18(24)12-27-19(25)13-7-9-14(26-2)10-8-13/h3-10H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | PXEYZZKJYLHBHP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |