C16H19ClN2O4 — CID 7717375
[2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] cyclobutanecarboxylate (PubChem CID 7717375) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] cyclobutanecarboxylate.
| Compound Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 7717375 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [2-[[2-(2-chloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] cyclobutanecarboxylate |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)C(=O)COC(=O)C1CCC1 |
| InChI | InChI=1S/C16H19ClN2O4/c1-19(15(21)10-23-16(22)11-5-4-6-11)9-14(20)18-13-8-3-2-7-12(13)17/h2-3,7-8,11H,4-6,9-10H2,1H3,(H,18,20) |
| InChIKey | FTYMYWRANHRQAE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |