C15H19ClN2O5 — CID 9014966
[2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate (PubChem CID 9014966) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate.
| Compound Name | [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 9014966 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)N(C)CC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H19ClN2O5/c1-4-15(21)23-9-14(20)18(2)8-13(19)17-11-7-10(16)5-6-12(11)22-3/h5-7H,4,8-9H2,1-3H3,(H,17,19) |
| InChIKey | MXLQYIFSSAFCHH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |