C20H30ClN3O3 — CID 8558739
N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-2-(cyclooctylamino)-N-methylacetamide (PubChem CID 8558739) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-2-(cyclooctylamino)-N-methylacetamide.
| Compound Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-2-(cyclooctylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 8558739 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-2-(cyclooctylamino)-N-methylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)CNC1CCCCCCC1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-24(20(26)13-22-16-8-6-4-3-5-7-9-16)14-19(25)23-17-12-15(21)10-11-18(17)27-2/h10-12,16,22H,3-9,13-14H2,1-2H3,(H,23,25) |
| InChIKey | ZXUQFBOIVFDDQI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |