C17H22ClN3O3S2 — CID 8580904
[2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 8580904) has the molecular formula C17H22ClN3O3S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8580904 |
| Molecular Formula | C17H22ClN3O3S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C17H22ClN3O3S2/c1-20(16(23)11-26-17(25)21-7-3-4-8-21)10-15(22)19-13-9-12(18)5-6-14(13)24-2/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H,19,22) |
| InChIKey | YTTYYKOQJKIJBB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|