C15H20N2O3S2 — CID 7606979
[2-(2,5-dimethoxyanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7606979) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606979 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(OC)c(NC(=O)CSC(=S)N2CCCC2)c1 |
| InChI | InChI=1S/C15H20N2O3S2/c1-19-11-5-6-13(20-2)12(9-11)16-14(18)10-22-15(21)17-7-3-4-8-17/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,16,18) |
| InChIKey | AXYXLDAIUIJIGU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|