C18H26N2O4 — CID 108958853
N-(2,5-dimethoxyphenyl)-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide (PubChem CID 108958853) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 108958853 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,2-dimethyl-3-oxo-3-piperidin-1-ylpropanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(C)(C)C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-18(2,17(22)20-10-6-5-7-11-20)16(21)19-14-12-13(23-3)8-9-15(14)24-4/h8-9,12H,5-7,10-11H2,1-4H3,(H,19,21) |
| InChIKey | LZQVKOCINBJVTP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|