C19H30N2O4 — CID 108966884
N-(2,5-dimethoxyphenyl)-2,2-dimethyl-N',N'-dipropylpropanediamide (PubChem CID 108966884) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,2-dimethyl-N',N'-dipropylpropanediamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2,2-dimethyl-N',N'-dipropylpropanediamide |
|---|---|
| PubChem CID | 108966884 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,2-dimethyl-N',N'-dipropylpropanediamide |
| SMILES | CCCN(CCC)C(=O)C(C)(C)C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H30N2O4/c1-7-11-21(12-8-2)18(23)19(3,4)17(22)20-15-13-14(24-5)9-10-16(15)25-6/h9-10,13H,7-8,11-12H2,1-6H3,(H,20,22) |
| InChIKey | SCLDZSJPCACTAD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|