C15H22N2O4 — CID 108511949
N'-butyl-N-(2,5-dimethoxyphenyl)-N'-methyloxamide (PubChem CID 108511949) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N'-butyl-N-(2,5-dimethoxyphenyl)-N'-methyloxamide.
| Compound Name | N'-butyl-N-(2,5-dimethoxyphenyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108511949 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N'-butyl-N-(2,5-dimethoxyphenyl)-N'-methyloxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H22N2O4/c1-5-6-9-17(2)15(19)14(18)16-12-10-11(20-3)7-8-13(12)21-4/h7-8,10H,5-6,9H2,1-4H3,(H,16,18) |
| InChIKey | CZOZRNLMUHFDKP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|