C18H21N3O4 — CID 108985621
N-(2,4-dimethoxyphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108985621) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108985621 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N(C)CCc2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-21(11-8-13-6-9-19-10-7-13)18(23)17(22)20-15-5-4-14(24-2)12-16(15)25-3/h4-7,9-10,12H,8,11H2,1-3H3,(H,20,22) |
| InChIKey | PJWJTHFNJUNTEL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|