C20H19N3O3 — CID 151817629
3-(2,4-dimethoxyphenyl)-1-phenyl-1-pyridin-4-ylurea (PubChem CID 151817629) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-phenyl-1-pyridin-4-ylurea.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-phenyl-1-pyridin-4-ylurea |
|---|---|
| PubChem CID | 151817629 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-phenyl-1-pyridin-4-ylurea |
| SMILES | COc1ccc(NC(=O)N(c2ccccc2)c2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-25-17-8-9-18(19(14-17)26-2)22-20(24)23(15-6-4-3-5-7-15)16-10-12-21-13-11-16/h3-14H,1-2H3,(H,22,24) |
| InChIKey | SBYHGTKVWDVNQH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |