C15H14N2O5 — CID 53271047
4-[(2,4-dimethoxyphenyl)carbamoyl]pyridine-3-carboxylic acid (PubChem CID 53271047) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)carbamoyl]pyridine-3-carboxylic acid.
| Compound Name | 4-[(2,4-dimethoxyphenyl)carbamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53271047 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)carbamoyl]pyridine-3-carboxylic acid |
| SMILES | COc1ccc(NC(=O)c2ccncc2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C15H14N2O5/c1-21-9-3-4-12(13(7-9)22-2)17-14(18)10-5-6-16-8-11(10)15(19)20/h3-8H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | KKTRGMOCNIBJQH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |