C16H16ClNO3 — CID 885610
2-chloro-N-(2,4-dimethoxyphenyl)-4-methylbenzamide (PubChem CID 885610) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethoxyphenyl)-4-methylbenzamide.
| Compound Name | 2-chloro-N-(2,4-dimethoxyphenyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 885610 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-chloro-N-(2,4-dimethoxyphenyl)-4-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C16H16ClNO3/c1-10-4-6-12(13(17)8-10)16(19)18-14-7-5-11(20-2)9-15(14)21-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | PBHQMAUXGGIHHV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |