C15H13BrClNO3 — CID 55883648
4-bromo-2-chloro-N-(2,5-dimethoxyphenyl)benzamide (PubChem CID 55883648) has the molecular formula C15H13BrClNO3 and a molecular weight of 370.63 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2,5-dimethoxyphenyl)benzamide.
| Compound Name | 4-bromo-2-chloro-N-(2,5-dimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 55883648 |
| Molecular Formula | C15H13BrClNO3 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 4-bromo-2-chloro-N-(2,5-dimethoxyphenyl)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C15H13BrClNO3/c1-20-10-4-6-14(21-2)13(8-10)18-15(19)11-5-3-9(16)7-12(11)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | KJKLKABBXZYJEZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |