C16H17NO3 — CID 101328675
N-(2,4-dimethoxyphenyl)-N-phenylacetamide (PubChem CID 101328675) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N-phenylacetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 101328675 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N-phenylacetamide |
| SMILES | COc1ccc(N(C(C)=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H17NO3/c1-12(18)17(13-7-5-4-6-8-13)15-10-9-14(19-2)11-16(15)20-3/h4-11H,1-3H3 |
| InChIKey | ZOJIMUBASWIYFJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |