C24H25NO5 — CID 71171207
2,4,5-trimethoxy-N-(2-methoxy-4-methylphenyl)-N-phenylbenzamide (PubChem CID 71171207) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-(2-methoxy-4-methylphenyl)-N-phenylbenzamide.
| Compound Name | 2,4,5-trimethoxy-N-(2-methoxy-4-methylphenyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 71171207 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2,4,5-trimethoxy-N-(2-methoxy-4-methylphenyl)-N-phenylbenzamide |
| SMILES | COc1cc(OC)c(C(=O)N(c2ccccc2)c2ccc(C)cc2OC)cc1OC |
| InChI | InChI=1S/C24H25NO5/c1-16-11-12-19(21(13-16)28-3)25(17-9-7-6-8-10-17)24(26)18-14-22(29-4)23(30-5)15-20(18)27-2/h6-15H,1-5H3 |
| InChIKey | NOLUAKKADQPUPV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |