C10H14N2O2 — CID 116845575
2-methoxy-N,5-dimethylbenzohydrazide (PubChem CID 116845575) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-methoxy-N,5-dimethylbenzohydrazide.
| Compound Name | 2-methoxy-N,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 116845575 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-methoxy-N,5-dimethylbenzohydrazide |
| SMILES | COc1ccc(C)cc1C(=O)N(C)N |
| InChI | InChI=1S/C10H14N2O2/c1-7-4-5-9(14-3)8(6-7)10(13)12(2)11/h4-6H,11H2,1-3H3 |
| InChIKey | JENMANOASVGEHJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|