C10H15N3O3 — CID 145124941
2-amino-4,5-dimethoxy-N-methylbenzohydrazide (PubChem CID 145124941) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxy-N-methylbenzohydrazide.
| Compound Name | 2-amino-4,5-dimethoxy-N-methylbenzohydrazide |
|---|---|
| PubChem CID | 145124941 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-amino-4,5-dimethoxy-N-methylbenzohydrazide |
| SMILES | COc1cc(N)c(C(=O)N(C)N)cc1OC |
| InChI | InChI=1S/C10H15N3O3/c1-13(12)10(14)6-4-8(15-2)9(16-3)5-7(6)11/h4-5H,11-12H2,1-3H3 |
| InChIKey | CASLEZOWLRTSOF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|