C9H10N2O6 — CID 174871974
nitro 2-amino-4,5-dimethoxybenzoate (PubChem CID 174871974) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is nitro 2-amino-4,5-dimethoxybenzoate.
| Compound Name | nitro 2-amino-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 174871974 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | nitro 2-amino-4,5-dimethoxybenzoate |
| SMILES | COc1cc(N)c(C(=O)O[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C9H10N2O6/c1-15-7-3-5(9(12)17-11(13)14)6(10)4-8(7)16-2/h3-4H,10H2,1-2H3 |
| InChIKey | PXPDGKICKPRRKJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|