C10H14BrNO3 — CID 172866698
1-(2-amino-4,5-dimethoxyphenyl)ethanone;hydrobromide (PubChem CID 172866698) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 1-(2-amino-4,5-dimethoxyphenyl)ethanone;hydrobromide.
| Compound Name | 1-(2-amino-4,5-dimethoxyphenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 172866698 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 1-(2-amino-4,5-dimethoxyphenyl)ethanone;hydrobromide |
| SMILES | Br.COc1cc(N)c(C(C)=O)cc1OC |
| InChI | InChI=1S/C10H13NO3.BrH/c1-6(12)7-4-9(13-2)10(14-3)5-8(7)11;/h4-5H,11H2,1-3H3;1H |
| InChIKey | AAEWIJCIRUWQAE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|