C8H11N3O — CID 163413679
1-(2,4,5-triaminophenyl)ethanone (PubChem CID 163413679) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-(2,4,5-triaminophenyl)ethanone.
| Compound Name | 1-(2,4,5-triaminophenyl)ethanone |
|---|---|
| PubChem CID | 163413679 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-(2,4,5-triaminophenyl)ethanone |
| SMILES | CC(=O)c1cc(N)c(N)cc1N |
| InChI | InChI=1S/C8H11N3O/c1-4(12)5-2-7(10)8(11)3-6(5)9/h2-3H,9-11H2,1H3 |
| InChIKey | ACPQICIEVQUMDW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|