C8H8Cl3NO — CID 71393549
1-(5-amino-2,4-dichlorophenyl)ethanone;hydrochloride (PubChem CID 71393549) has the molecular formula C8H8Cl3NO and a molecular weight of 240.52 g/mol. Its IUPAC name is 1-(5-amino-2,4-dichlorophenyl)ethanone;hydrochloride.
| Compound Name | 1-(5-amino-2,4-dichlorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 71393549 |
| Molecular Formula | C8H8Cl3NO |
| Molecular Weight | 240.52 g/mol |
| Exact Mass | 238.97 |
| IUPAC Name | 1-(5-amino-2,4-dichlorophenyl)ethanone;hydrochloride |
| SMILES | CC(=O)c1cc(N)c(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C8H7Cl2NO.ClH/c1-4(12)5-2-8(11)7(10)3-6(5)9;/h2-3H,11H2,1H3;1H |
| InChIKey | JLXNQHYKENWLGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|