C14H18Cl2N2O — CID 100804437
(5-amino-2,4-dichlorophenyl)-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 100804437) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is (5-amino-2,4-dichlorophenyl)-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | (5-amino-2,4-dichlorophenyl)-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100804437 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (5-amino-2,4-dichlorophenyl)-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)c2cc(N)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-8-3-9(2)7-18(6-8)14(19)10-4-13(17)12(16)5-11(10)15/h4-5,8-9H,3,6-7,17H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | HYGYXKRQAXFLDX-IUCAKERBSA-N |
| XLogP | 3.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|