C14H16ClF2NO — CID 29056304
(2-chloro-4,5-difluorophenyl)-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 29056304) has the molecular formula C14H16ClF2NO and a molecular weight of 287.74 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 29056304 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[(3R,5S)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H16ClF2NO/c1-8-3-9(2)7-18(6-8)14(19)10-4-12(16)13(17)5-11(10)15/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9+ |
| InChIKey | IMSFIVYEZFDDPY-DTORHVGOSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|