C19H23Cl2FN2O2 — CID 52718033
[1-(2,4-dichloro-5-fluorobenzoyl)piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 52718033) has the molecular formula C19H23Cl2FN2O2 and a molecular weight of 401.31 g/mol. Its IUPAC name is [1-(2,4-dichloro-5-fluorobenzoyl)piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [1-(2,4-dichloro-5-fluorobenzoyl)piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 52718033 |
| Molecular Formula | C19H23Cl2FN2O2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [1-(2,4-dichloro-5-fluorobenzoyl)piperidin-4-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CCN(C(=O)c3cc(F)c(Cl)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H23Cl2FN2O2/c1-12-2-6-23(7-3-12)18(25)13-4-8-24(9-5-13)19(26)14-10-17(22)16(21)11-15(14)20/h10-13H,2-9H2,1H3 |
| InChIKey | SNHITVDGSOIREY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|