C11H10ClF2NO — CID 82772045
(4-chloro-2,5-difluorophenyl)-pyrrolidin-1-ylmethanone (PubChem CID 82772045) has the molecular formula C11H10ClF2NO and a molecular weight of 245.66 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-pyrrolidin-1-ylmethanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 82772045 |
| Molecular Formula | C11H10ClF2NO |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1F)N1CCCC1 |
| InChI | InChI=1S/C11H10ClF2NO/c12-8-6-9(13)7(5-10(8)14)11(16)15-3-1-2-4-15/h5-6H,1-4H2 |
| InChIKey | YDHNASISHVGLSP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|