C14H15ClF2N2O — CID 82771946
(4-chloro-2,5-difluorophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone (PubChem CID 82771946) has the molecular formula C14H15ClF2N2O and a molecular weight of 300.74 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 82771946 |
| Molecular Formula | C14H15ClF2N2O |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1F)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C14H15ClF2N2O/c15-11-6-12(16)10(5-13(11)17)14(20)19-4-3-8-1-2-9(7-19)18-8/h5-6,8-9,18H,1-4,7H2 |
| InChIKey | OTXWLSSLTXXZTB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|