C14H16F2N2O — CID 81483822
3,9-diazabicyclo[4.2.1]nonan-3-yl-(2,5-difluorophenyl)methanone (PubChem CID 81483822) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is 3,9-diazabicyclo[4.2.1]nonan-3-yl-(2,5-difluorophenyl)methanone.
| Compound Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 81483822 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-(2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C14H16F2N2O/c15-9-1-4-13(16)12(7-9)14(19)18-6-5-10-2-3-11(8-18)17-10/h1,4,7,10-11,17H,2-3,5-6,8H2 |
| InChIKey | SUFCWHSGBFRKDI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |