C12H12BrF2NO — CID 80667046
[3-(bromomethyl)pyrrolidin-1-yl]-(2,5-difluorophenyl)methanone (PubChem CID 80667046) has the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. Its IUPAC name is [3-(bromomethyl)pyrrolidin-1-yl]-(2,5-difluorophenyl)methanone.
| Compound Name | [3-(bromomethyl)pyrrolidin-1-yl]-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 80667046 |
| Molecular Formula | C12H12BrF2NO |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | [3-(bromomethyl)pyrrolidin-1-yl]-(2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCC(CBr)C1 |
| InChI | InChI=1S/C12H12BrF2NO/c13-6-8-3-4-16(7-8)12(17)10-5-9(14)1-2-11(10)15/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | MPKNFPBNVLWVKD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|