C12H11ClF2N2O3 — CID 107323452
3-amino-1-(4-chloro-2,5-difluorobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 107323452) has the molecular formula C12H11ClF2N2O3 and a molecular weight of 304.68 g/mol. Its IUPAC name is 3-amino-1-(4-chloro-2,5-difluorobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(4-chloro-2,5-difluorobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107323452 |
| Molecular Formula | C12H11ClF2N2O3 |
| Molecular Weight | 304.68 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-amino-1-(4-chloro-2,5-difluorobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(C(=O)c2cc(F)c(Cl)cc2F)C1 |
| InChI | InChI=1S/C12H11ClF2N2O3/c13-7-4-8(14)6(3-9(7)15)10(18)17-2-1-12(16,5-17)11(19)20/h3-4H,1-2,5,16H2,(H,19,20) |
| InChIKey | QMORUOOROKUKGS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|