C14H17ClF2N2O — CID 82771490
[3-(2-aminoethyl)piperidin-1-yl]-(4-chloro-2,5-difluorophenyl)methanone (PubChem CID 82771490) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is [3-(2-aminoethyl)piperidin-1-yl]-(4-chloro-2,5-difluorophenyl)methanone.
| Compound Name | [3-(2-aminoethyl)piperidin-1-yl]-(4-chloro-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 82771490 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | [3-(2-aminoethyl)piperidin-1-yl]-(4-chloro-2,5-difluorophenyl)methanone |
| SMILES | NCCC1CCCN(C(=O)c2cc(F)c(Cl)cc2F)C1 |
| InChI | InChI=1S/C14H17ClF2N2O/c15-11-7-12(16)10(6-13(11)17)14(20)19-5-1-2-9(8-19)3-4-18/h6-7,9H,1-5,8,18H2 |
| InChIKey | PWBQGPFLEACNJU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|