C14H18ClFN2O — CID 117044940
[3-(aminomethyl)piperidin-1-yl]-(2-chloro-5-fluoro-4-methylphenyl)methanone (PubChem CID 117044940) has the molecular formula C14H18ClFN2O and a molecular weight of 284.76 g/mol. Its IUPAC name is [3-(aminomethyl)piperidin-1-yl]-(2-chloro-5-fluoro-4-methylphenyl)methanone.
| Compound Name | [3-(aminomethyl)piperidin-1-yl]-(2-chloro-5-fluoro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 117044940 |
| Molecular Formula | C14H18ClFN2O |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [3-(aminomethyl)piperidin-1-yl]-(2-chloro-5-fluoro-4-methylphenyl)methanone |
| SMILES | Cc1cc(Cl)c(C(=O)N2CCCC(CN)C2)cc1F |
| InChI | InChI=1S/C14H18ClFN2O/c1-9-5-12(15)11(6-13(9)16)14(19)18-4-2-3-10(7-17)8-18/h5-6,10H,2-4,7-8,17H2,1H3 |
| InChIKey | YEJBJESMUHCYFX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |