C12H14Cl2F2N2O — CID 119380155
(3-aminopiperidin-1-yl)-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride (PubChem CID 119380155) has the molecular formula C12H14Cl2F2N2O and a molecular weight of 311.16 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119380155 |
| Molecular Formula | C12H14Cl2F2N2O |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2-chloro-4,5-difluorophenyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C12H13ClF2N2O.ClH/c13-9-5-11(15)10(14)4-8(9)12(18)17-3-1-2-7(16)6-17;/h4-5,7H,1-3,6,16H2;1H |
| InChIKey | NRNGKXRNMKSSMQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|