2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid

C14H14ClF2NO3 — CID 78979755

IUPAC2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid
SMILESO=C(O)CC1CCN(C(=O)c2cc(F)c(F)cc2Cl)CC1
InChIInChI=1S/C14H14ClF2NO3/c15-10-7-12(17)11(16)6-9(10)14(21)18-3-1-8(2-4-18)5-13(19)20/h6-8H,1-5H2,(H,19,20)
InChIKeyDYJDCKLSZAQZCE-UHFFFAOYSA-N
MW317.72 g/mol
LogP2.95
Rot. Bonds3

About 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid

2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid (PubChem CID 78979755) has the molecular formula C14H14ClF2NO3 and a molecular weight of 317.72 g/mol. Its IUPAC name is 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid
PubChem CID78979755
Molecular FormulaC14H14ClF2NO3
Molecular Weight317.72 g/mol
Exact Mass317.06
IUPAC Name2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid
SMILESO=C(O)CC1CCN(C(=O)c2cc(F)c(F)cc2Cl)CC1
InChIInChI=1S/C14H14ClF2NO3/c15-10-7-12(17)11(16)6-9(10)14(21)18-3-1-8(2-4-18)5-13(19)20/h6-8H,1-5H2,(H,19,20)
InChIKeyDYJDCKLSZAQZCE-UHFFFAOYSA-N
XLogP2.95
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.72
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid (CID 78979755) is 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid is O=C(O)CC1CCN(C(=O)c2cc(F)c(F)cc2Cl)CC1.
What is the InChIKey of 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid?
The InChIKey is DYJDCKLSZAQZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF2NO3/c15-10-7-12(17)11(16)6-9(10)14(21)18-3-1-8(2-4-18)5-13(19)20/h6-8H,1-5H2,(H,19,20).
What are the key properties of 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid?
2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid has a molecular weight of 317.72 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-chloro-4,5-difluorobenzoyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 78979755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).