2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid

C14H15Cl2NO3 — CID 78980399

IUPAC2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid
SMILESO=C(O)CC1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1
InChIInChI=1S/C14H15Cl2NO3/c15-10-1-2-11(12(16)8-10)14(20)17-5-3-9(4-6-17)7-13(18)19/h1-2,8-9H,3-7H2,(H,18,19)
InChIKeyLHMRCVGYZDVJRE-UHFFFAOYSA-N
MW316.18 g/mol
LogP3.32
Rot. Bonds3

About 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid

2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid (PubChem CID 78980399) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid
PubChem CID78980399
Molecular FormulaC14H15Cl2NO3
Molecular Weight316.18 g/mol
Exact Mass315.04
IUPAC Name2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid
SMILESO=C(O)CC1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1
InChIInChI=1S/C14H15Cl2NO3/c15-10-1-2-11(12(16)8-10)14(20)17-5-3-9(4-6-17)7-13(18)19/h1-2,8-9H,3-7H2,(H,18,19)
InChIKeyLHMRCVGYZDVJRE-UHFFFAOYSA-N
XLogP3.32
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.18
LogP ≤ 53.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid (CID 78980399) is 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid is O=C(O)CC1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1.
What is the InChIKey of 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid?
The InChIKey is LHMRCVGYZDVJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c15-10-1-2-11(12(16)8-10)14(20)17-5-3-9(4-6-17)7-13(18)19/h1-2,8-9H,3-7H2,(H,18,19).
What are the key properties of 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid?
2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid has a molecular weight of 316.18 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dichlorobenzoyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 78980399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).