2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid

C13H13Cl2NO3 — CID 61372414

IUPAC2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCN1C(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H13Cl2NO3/c14-8-3-4-10(11(15)6-8)13(19)16-5-1-2-9(16)7-12(17)18/h3-4,6,9H,1-2,5,7H2,(H,17,18)
InChIKeyRQACOZVYMDVYKK-UHFFFAOYSA-N
MW302.16 g/mol
LogP3.07
Rot. Bonds3

About 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid

2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid (PubChem CID 61372414) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid
PubChem CID61372414
Molecular FormulaC13H13Cl2NO3
Molecular Weight302.16 g/mol
Exact Mass301.03
IUPAC Name2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid
SMILESO=C(O)CC1CCCN1C(=O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C13H13Cl2NO3/c14-8-3-4-10(11(15)6-8)13(19)16-5-1-2-9(16)7-12(17)18/h3-4,6,9H,1-2,5,7H2,(H,17,18)
InChIKeyRQACOZVYMDVYKK-UHFFFAOYSA-N
XLogP3.07
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.16
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid?
The IUPAC name of 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid (CID 61372414) is 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid.
What is the SMILES notation for 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid?
The canonical SMILES for 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid is O=C(O)CC1CCCN1C(=O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid?
The InChIKey is RQACOZVYMDVYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO3/c14-8-3-4-10(11(15)6-8)13(19)16-5-1-2-9(16)7-12(17)18/h3-4,6,9H,1-2,5,7H2,(H,17,18).
What are the key properties of 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid?
2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid has a molecular weight of 302.16 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dichlorobenzoyl)pyrrolidin-2-yl]acetic acid is sourced from PubChem (CID 61372414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).