C14H17FN2O3 — CID 79614807
2-[1-(2-amino-5-fluorobenzoyl)piperidin-4-yl]acetic acid (PubChem CID 79614807) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[1-(2-amino-5-fluorobenzoyl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(2-amino-5-fluorobenzoyl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 79614807 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[1-(2-amino-5-fluorobenzoyl)piperidin-4-yl]acetic acid |
| SMILES | Nc1ccc(F)cc1C(=O)N1CCC(CC(=O)O)CC1 |
| InChI | InChI=1S/C14H17FN2O3/c15-10-1-2-12(16)11(8-10)14(20)17-5-3-9(4-6-17)7-13(18)19/h1-2,8-9H,3-7,16H2,(H,18,19) |
| InChIKey | JZTBNIWKYCPWDC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|