C13H15ClF2N2O2 — CID 99716788
[(2S)-2-[(1S)-1-aminoethyl]morpholin-4-yl]-(2-chloro-4,5-difluorophenyl)methanone (PubChem CID 99716788) has the molecular formula C13H15ClF2N2O2 and a molecular weight of 304.72 g/mol. Its IUPAC name is [(2S)-2-[(1S)-1-aminoethyl]morpholin-4-yl]-(2-chloro-4,5-difluorophenyl)methanone.
| Compound Name | [(2S)-2-[(1S)-1-aminoethyl]morpholin-4-yl]-(2-chloro-4,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 99716788 |
| Molecular Formula | C13H15ClF2N2O2 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [(2S)-2-[(1S)-1-aminoethyl]morpholin-4-yl]-(2-chloro-4,5-difluorophenyl)methanone |
| SMILES | C[C@H](N)[C@@H]1CN(C(=O)c2cc(F)c(F)cc2Cl)CCO1 |
| InChI | InChI=1S/C13H15ClF2N2O2/c1-7(17)12-6-18(2-3-20-12)13(19)8-4-10(15)11(16)5-9(8)14/h4-5,7,12H,2-3,6,17H2,1H3/t7-,12-/m0/s1 |
| InChIKey | NOBFQGPMBKPHPR-MADCSZMMSA-N |
| XLogP | 1.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|